C17H13ClN2OS — CID 6434612
(5Z)-5-[(3-chlorophenyl)methylidene]-3-(3-methylphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 6434612) has the molecular formula C17H13ClN2OS and a molecular weight of 328.82 g/mol. Its IUPAC name is (5Z)-5-[(3-chlorophenyl)methylidene]-3-(3-methylphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(3-chlorophenyl)methylidene]-3-(3-methylphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 6434612 |
| Molecular Formula | C17H13ClN2OS |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | (5Z)-5-[(3-chlorophenyl)methylidene]-3-(3-methylphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1cccc(N2C(=O)/C(=C/c3cccc(Cl)c3)NC2=S)c1 |
| InChI | InChI=1S/C17H13ClN2OS/c1-11-4-2-7-14(8-11)20-16(21)15(19-17(20)22)10-12-5-3-6-13(18)9-12/h2-10H,1H3,(H,19,22)/b15-10- |
| InChIKey | HOBCRWRQKUSBII-GDNBJRDFSA-N |
| XLogP | 3.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|