C16H10BrClN2OS — CID 6434273
(5Z)-3-(4-bromophenyl)-5-[(3-chlorophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 6434273) has the molecular formula C16H10BrClN2OS and a molecular weight of 393.69 g/mol. Its IUPAC name is (5Z)-3-(4-bromophenyl)-5-[(3-chlorophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-(4-bromophenyl)-5-[(3-chlorophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 6434273 |
| Molecular Formula | C16H10BrClN2OS |
| Molecular Weight | 393.69 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | (5Z)-3-(4-bromophenyl)-5-[(3-chlorophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1/C(=C/c2cccc(Cl)c2)NC(=S)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H10BrClN2OS/c17-11-4-6-13(7-5-11)20-15(21)14(19-16(20)22)9-10-2-1-3-12(18)8-10/h1-9H,(H,19,22)/b14-9- |
| InChIKey | PMYXIPCHUXJSMD-ZROIWOOFSA-N |
| XLogP | 4.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.69 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|