C18H15BrN2OS — CID 26492858
(5E)-5-[(4-bromophenyl)methylidene]-3-(3-ethylphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 26492858) has the molecular formula C18H15BrN2OS and a molecular weight of 387.30 g/mol. Its IUPAC name is (5E)-5-[(4-bromophenyl)methylidene]-3-(3-ethylphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(4-bromophenyl)methylidene]-3-(3-ethylphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 26492858 |
| Molecular Formula | C18H15BrN2OS |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | (5E)-5-[(4-bromophenyl)methylidene]-3-(3-ethylphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCc1cccc(N2C(=O)/C(=C\c3ccc(Br)cc3)NC2=S)c1 |
| InChI | InChI=1S/C18H15BrN2OS/c1-2-12-4-3-5-15(10-12)21-17(22)16(20-18(21)23)11-13-6-8-14(19)9-7-13/h3-11H,2H2,1H3,(H,20,23)/b16-11+ |
| InChIKey | DJWLIYWCMBKDEO-LFIBNONCSA-N |
| XLogP | 4.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|