C27H22BrN3OS — CID 126151304
(5Z)-5-[[1-[(4-bromophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126151304) has the molecular formula C27H22BrN3OS and a molecular weight of 516.46 g/mol. Its IUPAC name is (5Z)-5-[[1-[(4-bromophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[(4-bromophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126151304 |
| Molecular Formula | C27H22BrN3OS |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | (5Z)-5-[[1-[(4-bromophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCc1cccc2c(/C=C3\NC(=S)N(c4ccccc4)C3=O)cn(Cc3ccc(Br)cc3)c12 |
| InChI | InChI=1S/C27H22BrN3OS/c1-2-19-7-6-10-23-20(17-30(25(19)23)16-18-11-13-21(28)14-12-18)15-24-26(32)31(27(33)29-24)22-8-4-3-5-9-22/h3-15,17H,2,16H2,1H3,(H,29,33)/b24-15- |
| InChIKey | OYQCKHHMFJAWKX-IWIPYMOSSA-N |
| XLogP | 6.28 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|