C27H28N4O2S — CID 44714014
(5Z)-5-[[7-ethyl-1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 44714014) has the molecular formula C27H28N4O2S and a molecular weight of 472.61 g/mol. Its IUPAC name is (5Z)-5-[[7-ethyl-1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[7-ethyl-1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 44714014 |
| Molecular Formula | C27H28N4O2S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | (5Z)-5-[[7-ethyl-1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCc1cccc2c(/C=C3\NC(=S)N(c4ccccc4)C3=O)cn(CC(=O)N3CCCCC3)c12 |
| InChI | InChI=1S/C27H28N4O2S/c1-2-19-10-9-13-22-20(17-30(25(19)22)18-24(32)29-14-7-4-8-15-29)16-23-26(33)31(27(34)28-23)21-11-5-3-6-12-21/h3,5-6,9-13,16-17H,2,4,7-8,14-15,18H2,1H3,(H,28,34)/b23-16- |
| InChIKey | UHQNWNWGYXPOLE-KQWNVCNZSA-N |
| XLogP | 4.48 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|