C29H32N4O2S — CID 126143973
(5Z)-5-[[1-[2-(azepan-1-yl)-2-oxoethyl]-7-ethylindol-3-yl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126143973) has the molecular formula C29H32N4O2S and a molecular weight of 500.67 g/mol. Its IUPAC name is (5Z)-5-[[1-[2-(azepan-1-yl)-2-oxoethyl]-7-ethylindol-3-yl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[2-(azepan-1-yl)-2-oxoethyl]-7-ethylindol-3-yl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126143973 |
| Molecular Formula | C29H32N4O2S |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | (5Z)-5-[[1-[2-(azepan-1-yl)-2-oxoethyl]-7-ethylindol-3-yl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCc1cccc2c(/C=C3/C(=O)N(c4ccccc4)C(=S)N3C)cn(CC(=O)N3CCCCCC3)c12 |
| InChI | InChI=1S/C29H32N4O2S/c1-3-21-12-11-15-24-22(19-32(27(21)24)20-26(34)31-16-9-4-5-10-17-31)18-25-28(35)33(29(36)30(25)2)23-13-7-6-8-14-23/h6-8,11-15,18-19H,3-5,9-10,16-17,20H2,1-2H3/b25-18- |
| InChIKey | XXUWMQSAEIOMIU-BWAHOGKJSA-N |
| XLogP | 5.21 |
| TPSA | 48.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|