C30H29N3O2S — CID 44714060
(5Z)-5-[(1-benzyl-7-ethylindol-3-yl)methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 44714060) has the molecular formula C30H29N3O2S and a molecular weight of 495.65 g/mol. Its IUPAC name is (5Z)-5-[(1-benzyl-7-ethylindol-3-yl)methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(1-benzyl-7-ethylindol-3-yl)methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 44714060 |
| Molecular Formula | C30H29N3O2S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | (5Z)-5-[(1-benzyl-7-ethylindol-3-yl)methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3cn(Cc4ccccc4)c4c(CC)cccc34)N(C)C2=S)cc1 |
| InChI | InChI=1S/C30H29N3O2S/c1-4-22-12-9-13-26-23(20-32(28(22)26)19-21-10-7-6-8-11-21)18-27-29(34)33(30(36)31(27)3)24-14-16-25(17-15-24)35-5-2/h6-18,20H,4-5,19H2,1-3H3/b27-18- |
| InChIKey | KBXXYOQXWJNDQW-IMRQLAEWSA-N |
| XLogP | 6.26 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|