C30H27ClFN3O2S — CID 126132706
(5Z)-5-[[1-[(2-chloro-6-fluorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126132706) has the molecular formula C30H27ClFN3O2S and a molecular weight of 548.08 g/mol. Its IUPAC name is (5Z)-5-[[1-[(2-chloro-6-fluorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[(2-chloro-6-fluorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126132706 |
| Molecular Formula | C30H27ClFN3O2S |
| Molecular Weight | 548.08 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | (5Z)-5-[[1-[(2-chloro-6-fluorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-(4-ethoxyphenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3cn(Cc4c(F)cccc4Cl)c4c(CC)cccc34)N(C)C2=S)cc1 |
| InChI | InChI=1S/C30H27ClFN3O2S/c1-4-19-8-6-9-23-20(17-34(28(19)23)18-24-25(31)10-7-11-26(24)32)16-27-29(36)35(30(38)33(27)3)21-12-14-22(15-13-21)37-5-2/h6-17H,4-5,18H2,1-3H3/b27-16- |
| InChIKey | OQTGHPUUOYZBFP-YUMHPJSZSA-N |
| XLogP | 7.05 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.08 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|