C24H23Cl2N3OS — CID 44714064
(5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 44714064) has the molecular formula C24H23Cl2N3OS and a molecular weight of 472.44 g/mol. Its IUPAC name is (5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 44714064 |
| Molecular Formula | C24H23Cl2N3OS |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | (5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCc1cccc2c(/C=C3/C(=O)N(CC)C(=S)N3C)cn(Cc3ccc(Cl)cc3Cl)c12 |
| InChI | InChI=1S/C24H23Cl2N3OS/c1-4-15-7-6-8-19-17(11-21-23(30)29(5-2)24(31)27(21)3)14-28(22(15)19)13-16-9-10-18(25)12-20(16)26/h6-12,14H,4-5,13H2,1-3H3/b21-11- |
| InChIKey | VHTCWUPNKIZBQB-NHDPSOOVSA-N |
| XLogP | 5.98 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|