C26H17BrCl3N3OS — CID 126154621
(5Z)-5-[[5-bromo-1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-(4-chlorophenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126154621) has the molecular formula C26H17BrCl3N3OS and a molecular weight of 605.77 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-(4-chlorophenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[5-bromo-1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-(4-chlorophenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126154621 |
| Molecular Formula | C26H17BrCl3N3OS |
| Molecular Weight | 605.77 g/mol |
| Exact Mass | 602.93 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-(4-chlorophenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=S)N(c2ccc(Cl)cc2)C(=O)/C1=C/c1cn(Cc2ccc(Cl)cc2Cl)c2ccc(Br)cc12 |
| InChI | InChI=1S/C26H17BrCl3N3OS/c1-31-24(25(34)33(26(31)35)20-7-5-18(28)6-8-20)10-16-14-32(23-9-3-17(27)11-21(16)23)13-15-2-4-19(29)12-22(15)30/h2-12,14H,13H2,1H3/b24-10- |
| InChIKey | YQBLCMPBXGMJIK-VROXFSQNSA-N |
| XLogP | 8.02 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.77 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|