C26H19BrClN3OS — CID 126153127
(5Z)-5-[(1-benzyl-5-bromoindol-3-yl)methylidene]-3-(4-chlorophenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126153127) has the molecular formula C26H19BrClN3OS and a molecular weight of 536.88 g/mol. Its IUPAC name is (5Z)-5-[(1-benzyl-5-bromoindol-3-yl)methylidene]-3-(4-chlorophenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(1-benzyl-5-bromoindol-3-yl)methylidene]-3-(4-chlorophenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126153127 |
| Molecular Formula | C26H19BrClN3OS |
| Molecular Weight | 536.88 g/mol |
| Exact Mass | 535.01 |
| IUPAC Name | (5Z)-5-[(1-benzyl-5-bromoindol-3-yl)methylidene]-3-(4-chlorophenyl)-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=S)N(c2ccc(Cl)cc2)C(=O)/C1=C/c1cn(Cc2ccccc2)c2ccc(Br)cc12 |
| InChI | InChI=1S/C26H19BrClN3OS/c1-29-24(25(32)31(26(29)33)21-10-8-20(28)9-11-21)13-18-16-30(15-17-5-3-2-4-6-17)23-12-7-19(27)14-22(18)23/h2-14,16H,15H2,1H3/b24-13- |
| InChIKey | UEAHJVWAMODFSK-CFRMEGHHSA-N |
| XLogP | 6.71 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.88 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|