C28H24ClN3O2S — CID 126139388
(5Z)-3-(4-chlorophenyl)-1-methyl-5-[[1-(3-phenoxypropyl)indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 126139388) has the molecular formula C28H24ClN3O2S and a molecular weight of 502.04 g/mol. Its IUPAC name is (5Z)-3-(4-chlorophenyl)-1-methyl-5-[[1-(3-phenoxypropyl)indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-(4-chlorophenyl)-1-methyl-5-[[1-(3-phenoxypropyl)indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126139388 |
| Molecular Formula | C28H24ClN3O2S |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | (5Z)-3-(4-chlorophenyl)-1-methyl-5-[[1-(3-phenoxypropyl)indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1C(=S)N(c2ccc(Cl)cc2)C(=O)/C1=C/c1cn(CCCOc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C28H24ClN3O2S/c1-30-26(27(33)32(28(30)35)22-14-12-21(29)13-15-22)18-20-19-31(25-11-6-5-10-24(20)25)16-7-17-34-23-8-3-2-4-9-23/h2-6,8-15,18-19H,7,16-17H2,1H3/b26-18- |
| InChIKey | ZJFJWHRSTUEAPL-ITYLOYPMSA-N |
| XLogP | 6.37 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|