C28H24ClN3O3S — CID 126140922
(5Z)-3-(4-chlorophenyl)-5-[[1-[2-(4-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126140922) has the molecular formula C28H24ClN3O3S and a molecular weight of 518.04 g/mol. Its IUPAC name is (5Z)-3-(4-chlorophenyl)-5-[[1-[2-(4-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-(4-chlorophenyl)-5-[[1-[2-(4-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126140922 |
| Molecular Formula | C28H24ClN3O3S |
| Molecular Weight | 518.04 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | (5Z)-3-(4-chlorophenyl)-5-[[1-[2-(4-methoxyphenoxy)ethyl]indol-3-yl]methylidene]-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(OCCn2cc(/C=C3/C(=O)N(c4ccc(Cl)cc4)C(=S)N3C)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H24ClN3O3S/c1-30-26(27(33)32(28(30)36)21-9-7-20(29)8-10-21)17-19-18-31(25-6-4-3-5-24(19)25)15-16-35-23-13-11-22(34-2)12-14-23/h3-14,17-18H,15-16H2,1-2H3/b26-17- |
| InChIKey | SODSKYUUXBQUGW-ONUIUJJFSA-N |
| XLogP | 5.99 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.04 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|