C29H27N3O2S — CID 44714405
(5Z)-1-methyl-5-[[1-[3-(4-methylphenoxy)propyl]indol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 44714405) has the molecular formula C29H27N3O2S and a molecular weight of 481.62 g/mol. Its IUPAC name is (5Z)-1-methyl-5-[[1-[3-(4-methylphenoxy)propyl]indol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-1-methyl-5-[[1-[3-(4-methylphenoxy)propyl]indol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 44714405 |
| Molecular Formula | C29H27N3O2S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (5Z)-1-methyl-5-[[1-[3-(4-methylphenoxy)propyl]indol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1ccc(OCCCn2cc(/C=C3/C(=O)N(c4ccccc4)C(=S)N3C)c3ccccc32)cc1 |
| InChI | InChI=1S/C29H27N3O2S/c1-21-13-15-24(16-14-21)34-18-8-17-31-20-22(25-11-6-7-12-26(25)31)19-27-28(33)32(29(35)30(27)2)23-9-4-3-5-10-23/h3-7,9-16,19-20H,8,17-18H2,1-2H3/b27-19- |
| InChIKey | KAGQBGZCTLKJTK-DIBXZPPDSA-N |
| XLogP | 6.02 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|