C30H29N3O3S — CID 126142393
(5Z)-1-methyl-3-phenyl-5-[[1-[2-(4-propan-2-yloxyphenoxy)ethyl]indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 126142393) has the molecular formula C30H29N3O3S and a molecular weight of 511.65 g/mol. Its IUPAC name is (5Z)-1-methyl-3-phenyl-5-[[1-[2-(4-propan-2-yloxyphenoxy)ethyl]indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-1-methyl-3-phenyl-5-[[1-[2-(4-propan-2-yloxyphenoxy)ethyl]indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126142393 |
| Molecular Formula | C30H29N3O3S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | (5Z)-1-methyl-3-phenyl-5-[[1-[2-(4-propan-2-yloxyphenoxy)ethyl]indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CC(C)Oc1ccc(OCCn2cc(/C=C3/C(=O)N(c4ccccc4)C(=S)N3C)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H29N3O3S/c1-21(2)36-25-15-13-24(14-16-25)35-18-17-32-20-22(26-11-7-8-12-27(26)32)19-28-29(34)33(30(37)31(28)3)23-9-5-4-6-10-23/h4-16,19-21H,17-18H2,1-3H3/b28-19- |
| InChIKey | RZZBMRNJQYJBNZ-USHMODERSA-N |
| XLogP | 6.11 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|