C28H26N2O4S2 — CID 126141407
(5Z)-3-(furan-2-ylmethyl)-5-[[1-[2-(4-propan-2-yloxyphenoxy)ethyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126141407) has the molecular formula C28H26N2O4S2 and a molecular weight of 518.66 g/mol. Its IUPAC name is (5Z)-3-(furan-2-ylmethyl)-5-[[1-[2-(4-propan-2-yloxyphenoxy)ethyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(furan-2-ylmethyl)-5-[[1-[2-(4-propan-2-yloxyphenoxy)ethyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126141407 |
| Molecular Formula | C28H26N2O4S2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | (5Z)-3-(furan-2-ylmethyl)-5-[[1-[2-(4-propan-2-yloxyphenoxy)ethyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)Oc1ccc(OCCn2cc(/C=C3\SC(=S)N(Cc4ccco4)C3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H26N2O4S2/c1-19(2)34-22-11-9-21(10-12-22)33-15-13-29-17-20(24-7-3-4-8-25(24)29)16-26-27(31)30(28(35)36-26)18-23-6-5-14-32-23/h3-12,14,16-17,19H,13,15,18H2,1-2H3/b26-16- |
| InChIKey | PXBZGOJTIOVKLC-QQXSKIMKSA-N |
| XLogP | 6.50 |
| TPSA | 56.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|