C23H22BrN3O2S — CID 44714332
(5Z)-5-[[5-bromo-1-[2-(4-methylphenoxy)ethyl]indol-3-yl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 44714332) has the molecular formula C23H22BrN3O2S and a molecular weight of 484.42 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[2-(4-methylphenoxy)ethyl]indol-3-yl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[5-bromo-1-[2-(4-methylphenoxy)ethyl]indol-3-yl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 44714332 |
| Molecular Formula | C23H22BrN3O2S |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[2-(4-methylphenoxy)ethyl]indol-3-yl]methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1ccc(OCCn2cc(/C=C3/C(=O)N(C)C(=S)N3C)c3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C23H22BrN3O2S/c1-15-4-7-18(8-5-15)29-11-10-27-14-16(19-13-17(24)6-9-20(19)27)12-21-22(28)26(3)23(30)25(21)2/h4-9,12-14H,10-11H2,1-3H3/b21-12- |
| InChIKey | BJZAFKMFWADSOS-MTJSOVHGSA-N |
| XLogP | 4.82 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|