C27H26BrN3O5S — CID 126147891
(5Z)-5-[[5-bromo-1-[2-(4-methylphenoxy)ethyl]indol-3-yl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126147891) has the molecular formula C27H26BrN3O5S and a molecular weight of 584.49 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[2-(4-methylphenoxy)ethyl]indol-3-yl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-1-[2-(4-methylphenoxy)ethyl]indol-3-yl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126147891 |
| Molecular Formula | C27H26BrN3O5S |
| Molecular Weight | 584.49 g/mol |
| Exact Mass | 583.08 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[2-(4-methylphenoxy)ethyl]indol-3-yl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(OCCn2cc(/C=C3\SC(=O)N(CC(=O)N4CCOCC4)C3=O)c3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C27H26BrN3O5S/c1-18-2-5-21(6-3-18)36-13-10-30-16-19(22-15-20(28)4-7-23(22)30)14-24-26(33)31(27(34)37-24)17-25(32)29-8-11-35-12-9-29/h2-7,14-16H,8-13,17H2,1H3/b24-14- |
| InChIKey | VXPDWFWGJANGMW-OYKKKHCWSA-N |
| XLogP | 4.69 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|