C28H27BrFN3O4S — CID 126130169
(5Z)-5-[[5-bromo-1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126130169) has the molecular formula C28H27BrFN3O4S and a molecular weight of 600.51 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126130169 |
| Molecular Formula | C28H27BrFN3O4S |
| Molecular Weight | 600.51 g/mol |
| Exact Mass | 599.09 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]indol-3-yl]methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC1CCN(C(=O)Cn2cc(/C=C3\SC(=O)N(CCOc4ccc(F)cc4)C3=O)c3cc(Br)ccc32)CC1 |
| InChI | InChI=1S/C28H27BrFN3O4S/c1-18-8-10-31(11-9-18)26(34)17-32-16-19(23-15-20(29)2-7-24(23)32)14-25-27(35)33(28(36)38-25)12-13-37-22-5-3-21(30)4-6-22/h2-7,14-16,18H,8-13,17H2,1H3/b25-14- |
| InChIKey | FFRPLNHCHMVYNY-QFEZKATASA-N |
| XLogP | 5.92 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|