C28H21BrClFN2O4S — CID 126155395
(5Z)-5-[[5-bromo-1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126155395) has the molecular formula C28H21BrClFN2O4S and a molecular weight of 615.91 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126155395 |
| Molecular Formula | C28H21BrClFN2O4S |
| Molecular Weight | 615.91 g/mol |
| Exact Mass | 614.01 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[2-(2-chlorophenoxy)ethyl]indol-3-yl]methylidene]-3-[2-(4-fluorophenoxy)ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cn(CCOc3ccccc3Cl)c3ccc(Br)cc23)C(=O)N1CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C28H21BrClFN2O4S/c29-19-5-10-24-22(16-19)18(17-32(24)11-13-37-25-4-2-1-3-23(25)30)15-26-27(34)33(28(35)38-26)12-14-36-21-8-6-20(31)7-9-21/h1-10,15-17H,11-14H2/b26-15- |
| InChIKey | XPLIRDMNBKAZKF-YSMPRRRNSA-N |
| XLogP | 7.39 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.91 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|