C28H20BrCl3N2O3S — CID 126136933
(5Z)-5-[[5-bromo-1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126136933) has the molecular formula C28H20BrCl3N2O3S and a molecular weight of 650.81 g/mol. Its IUPAC name is (5Z)-5-[[5-bromo-1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-bromo-1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126136933 |
| Molecular Formula | C28H20BrCl3N2O3S |
| Molecular Weight | 650.81 g/mol |
| Exact Mass | 647.94 |
| IUPAC Name | (5Z)-5-[[5-bromo-1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylidene]-3-[(2,4-dichlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cn(CCCOc3ccccc3Cl)c3ccc(Br)cc23)C(=O)N1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H20BrCl3N2O3S/c29-19-7-9-24-21(13-19)18(15-33(24)10-3-11-37-25-5-2-1-4-22(25)31)12-26-27(35)34(28(36)38-26)16-17-6-8-20(30)14-23(17)32/h1-2,4-9,12-15H,3,10-11,16H2/b26-12- |
| InChIKey | WWVFOLYJLCJQTK-ZRGSRPPYSA-N |
| XLogP | 9.07 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.81 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|