C26H17Cl2FN2O2S — CID 6525156
(5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 6525156) has the molecular formula C26H17Cl2FN2O2S and a molecular weight of 511.41 g/mol. Its IUPAC name is (5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6525156 |
| Molecular Formula | C26H17Cl2FN2O2S |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | (5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cn(Cc3ccc(Cl)cc3Cl)c3ccccc23)C(=O)N1Cc1ccccc1F |
| InChI | InChI=1S/C26H17Cl2FN2O2S/c27-19-10-9-16(21(28)12-19)13-30-14-18(20-6-2-4-8-23(20)30)11-24-25(32)31(26(33)34-24)15-17-5-1-3-7-22(17)29/h1-12,14H,13,15H2/b24-11- |
| InChIKey | LPRWJJOTWSDCIJ-MYKKPKGFSA-N |
| XLogP | 7.37 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|