C22H18Cl2N2O2S — CID 124664810
(5E)-3-[(2,4-dichlorophenyl)methyl]-5-[(1-propan-2-ylindol-3-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124664810) has the molecular formula C22H18Cl2N2O2S and a molecular weight of 445.37 g/mol. Its IUPAC name is (5E)-3-[(2,4-dichlorophenyl)methyl]-5-[(1-propan-2-ylindol-3-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2,4-dichlorophenyl)methyl]-5-[(1-propan-2-ylindol-3-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124664810 |
| Molecular Formula | C22H18Cl2N2O2S |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | (5E)-3-[(2,4-dichlorophenyl)methyl]-5-[(1-propan-2-ylindol-3-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)n1cc(/C=C2/SC(=O)N(Cc3ccc(Cl)cc3Cl)C2=O)c2ccccc21 |
| InChI | InChI=1S/C22H18Cl2N2O2S/c1-13(2)25-12-15(17-5-3-4-6-19(17)25)9-20-21(27)26(22(28)29-20)11-14-7-8-16(23)10-18(14)24/h3-10,12-13H,11H2,1-2H3/b20-9+ |
| InChIKey | SAFKXABUKYHTEL-AWQFTUOYSA-N |
| XLogP | 6.77 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|