C17H9Cl4NO2S — CID 124664513
(5E)-3-[(2,4-dichlorophenyl)methyl]-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124664513) has the molecular formula C17H9Cl4NO2S and a molecular weight of 433.14 g/mol. Its IUPAC name is (5E)-3-[(2,4-dichlorophenyl)methyl]-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2,4-dichlorophenyl)methyl]-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124664513 |
| Molecular Formula | C17H9Cl4NO2S |
| Molecular Weight | 433.14 g/mol |
| Exact Mass | 430.91 |
| IUPAC Name | (5E)-3-[(2,4-dichlorophenyl)methyl]-5-[(2,4-dichlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(Cl)cc2Cl)C(=O)N1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H9Cl4NO2S/c18-11-3-1-9(13(20)6-11)5-15-16(23)22(17(24)25-15)8-10-2-4-12(19)7-14(10)21/h1-7H,8H2/b15-5+ |
| InChIKey | JFRGJLBKCDMBQE-PJQLUOCWSA-N |
| XLogP | 6.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.14 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|