C28H25Cl3N2O3S — CID 124663507
(5E)-3-[(2-chlorophenyl)methyl]-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 124663507) has the molecular formula C28H25Cl3N2O3S and a molecular weight of 575.95 g/mol. Its IUPAC name is (5E)-3-[(2-chlorophenyl)methyl]-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-chlorophenyl)methyl]-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124663507 |
| Molecular Formula | C28H25Cl3N2O3S |
| Molecular Weight | 575.95 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | (5E)-3-[(2-chlorophenyl)methyl]-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCN(CC)c1ccc(/C=C2/SC(=O)N(Cc3ccccc3Cl)C2=O)c(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C28H25Cl3N2O3S/c1-3-32(4-2)22-12-10-18(25(15-22)36-17-20-9-11-21(29)14-24(20)31)13-26-27(34)33(28(35)37-26)16-19-7-5-6-8-23(19)30/h5-15H,3-4,16-17H2,1-2H3/b26-13+ |
| InChIKey | HBMBSYXNSKORMN-LGJNPRDNSA-N |
| XLogP | 8.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.95 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|