C26H28Cl2N2O5S — CID 124642677
propan-2-yl 2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 124642677) has the molecular formula C26H28Cl2N2O5S and a molecular weight of 551.49 g/mol. Its IUPAC name is propan-2-yl 2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 124642677 |
| Molecular Formula | C26H28Cl2N2O5S |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | propan-2-yl 2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCN(CC)c1ccc(/C=C2/SC(=O)N(CC(=O)OC(C)C)C2=O)c(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C26H28Cl2N2O5S/c1-5-29(6-2)20-10-8-17(22(13-20)34-15-18-7-9-19(27)12-21(18)28)11-23-25(32)30(26(33)36-23)14-24(31)35-16(3)4/h7-13,16H,5-6,14-15H2,1-4H3/b23-11+ |
| InChIKey | WLRHXDVIIYOFAS-FOKLQQMPSA-N |
| XLogP | 6.41 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|