C32H30Cl3N3O6S — CID 126163186
ethyl 2-chloro-5-[[2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 126163186) has the molecular formula C32H30Cl3N3O6S and a molecular weight of 691.03 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 126163186 |
| Molecular Formula | C32H30Cl3N3O6S |
| Molecular Weight | 691.03 g/mol |
| Exact Mass | 689.09 |
| IUPAC Name | ethyl 2-chloro-5-[[2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)CN2C(=O)S/C(=C/c3ccc(N(CC)CC)cc3OCc3ccc(Cl)cc3Cl)C2=O)ccc1Cl |
| InChI | InChI=1S/C32H30Cl3N3O6S/c1-4-37(5-2)23-11-8-19(27(16-23)44-18-20-7-9-21(33)14-26(20)35)13-28-30(40)38(32(42)45-28)17-29(39)36-22-10-12-25(34)24(15-22)31(41)43-6-3/h7-16H,4-6,17-18H2,1-3H3,(H,36,39)/b28-13+ |
| InChIKey | SZPCBGMRAVJAQC-XODNFHPESA-N |
| XLogP | 7.92 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.03 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|