C28H31Cl2N3O4S — CID 124642837
(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 124642837) has the molecular formula C28H31Cl2N3O4S and a molecular weight of 576.55 g/mol. Its IUPAC name is (5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124642837 |
| Molecular Formula | C28H31Cl2N3O4S |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | (5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCN(CC)c1ccc(/C=C2/SC(=O)N(CC(=O)N3CCCCC3)C2=O)c(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C28H31Cl2N3O4S/c1-3-31(4-2)22-11-9-19(24(16-22)37-18-20-8-10-21(29)15-23(20)30)14-25-27(35)33(28(36)38-25)17-26(34)32-12-6-5-7-13-32/h8-11,14-16H,3-7,12-13,17-18H2,1-2H3/b25-14+ |
| InChIKey | SVEPMZFMJZEQOS-AFUMVMLFSA-N |
| XLogP | 6.47 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|