C29H29Cl2N3O2S2 — CID 126338691
(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-3-[4-(dimethylamino)phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126338691) has the molecular formula C29H29Cl2N3O2S2 and a molecular weight of 586.61 g/mol. Its IUPAC name is (5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-3-[4-(dimethylamino)phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-3-[4-(dimethylamino)phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126338691 |
| Molecular Formula | C29H29Cl2N3O2S2 |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | (5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-3-[4-(dimethylamino)phenyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN(CC)c1ccc(/C=C2/SC(=S)N(c3ccc(N(C)C)cc3)C2=O)c(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C29H29Cl2N3O2S2/c1-5-33(6-2)24-10-8-19(26(17-24)36-18-20-7-9-21(30)16-25(20)31)15-27-28(35)34(29(37)38-27)23-13-11-22(12-14-23)32(3)4/h7-17H,5-6,18H2,1-4H3/b27-15+ |
| InChIKey | QDUIMVRZVBIULZ-JFLMPSFJSA-N |
| XLogP | 7.89 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|