C28H26Cl2N2O2S3 — CID 126345729
(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126345729) has the molecular formula C28H26Cl2N2O2S3 and a molecular weight of 589.64 g/mol. Its IUPAC name is (5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126345729 |
| Molecular Formula | C28H26Cl2N2O2S3 |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 588.05 |
| IUPAC Name | (5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]methylidene]-3-(3-methylsulfanylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN(CC)c1ccc(/C=C2/SC(=S)N(c3cccc(SC)c3)C2=O)c(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C28H26Cl2N2O2S3/c1-4-31(5-2)21-12-10-18(25(16-21)34-17-19-9-11-20(29)14-24(19)30)13-26-27(33)32(28(35)37-26)22-7-6-8-23(15-22)36-3/h6-16H,4-5,17H2,1-3H3/b26-13+ |
| InChIKey | WTLNQQWEVIUZRK-LGJNPRDNSA-N |
| XLogP | 8.55 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|