C24H15Cl2NO4S2 — CID 4268715
3-[5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 4268715) has the molecular formula C24H15Cl2NO4S2 and a molecular weight of 516.43 g/mol. Its IUPAC name is 3-[5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 3-[5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 4268715 |
| Molecular Formula | C24H15Cl2NO4S2 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 514.98 |
| IUPAC Name | 3-[5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2C(=O)C(=Cc3ccccc3OCc3ccc(Cl)cc3Cl)SC2=S)c1 |
| InChI | InChI=1S/C24H15Cl2NO4S2/c25-17-9-8-16(19(26)12-17)13-31-20-7-2-1-4-14(20)11-21-22(28)27(24(32)33-21)18-6-3-5-15(10-18)23(29)30/h1-12H,13H2,(H,29,30) |
| InChIKey | YIIOTGYPWJDOCL-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|