C27H17Cl2NO2S2 — CID 126347943
(5Z)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-naphthalen-1-yl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126347943) has the molecular formula C27H17Cl2NO2S2 and a molecular weight of 522.48 g/mol. Its IUPAC name is (5Z)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-naphthalen-1-yl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-naphthalen-1-yl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126347943 |
| Molecular Formula | C27H17Cl2NO2S2 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 521.01 |
| IUPAC Name | (5Z)-5-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-naphthalen-1-yl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccccc2OCc2ccc(Cl)cc2Cl)SC(=S)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C27H17Cl2NO2S2/c28-20-13-12-19(22(29)15-20)16-32-24-11-4-2-7-18(24)14-25-26(31)30(27(33)34-25)23-10-5-8-17-6-1-3-9-21(17)23/h1-15H,16H2/b25-14- |
| InChIKey | CFKZHVZFZUPYRA-QFEZKATASA-N |
| XLogP | 8.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|