C24H15Cl4NO3S2 — CID 126338397
(5Z)-3-(2,4-dichlorophenyl)-5-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126338397) has the molecular formula C24H15Cl4NO3S2 and a molecular weight of 571.33 g/mol. Its IUPAC name is (5Z)-3-(2,4-dichlorophenyl)-5-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2,4-dichlorophenyl)-5-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126338397 |
| Molecular Formula | C24H15Cl4NO3S2 |
| Molecular Weight | 571.33 g/mol |
| Exact Mass | 568.92 |
| IUPAC Name | (5Z)-3-(2,4-dichlorophenyl)-5-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(/C=C2\SC(=S)N(c3ccc(Cl)cc3Cl)C2=O)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H15Cl4NO3S2/c1-31-20-4-2-3-13(22(20)32-12-14-5-6-15(25)10-17(14)27)9-21-23(30)29(24(33)34-21)19-8-7-16(26)11-18(19)28/h2-11H,12H2,1H3/b21-9- |
| InChIKey | QNMIAZBUYYHOJN-NKVSQWTQSA-N |
| XLogP | 8.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.33 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|