C29H28N4O5S3 — CID 126339681
2-[5-(diethylamino)-2-[(E)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-nitrophenyl)acetamide (PubChem CID 126339681) has the molecular formula C29H28N4O5S3 and a molecular weight of 608.77 g/mol. Its IUPAC name is 2-[5-(diethylamino)-2-[(E)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[5-(diethylamino)-2-[(E)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126339681 |
| Molecular Formula | C29H28N4O5S3 |
| Molecular Weight | 608.77 g/mol |
| Exact Mass | 608.12 |
| IUPAC Name | 2-[5-(diethylamino)-2-[(E)-[3-(3-methylsulfanylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3-nitrophenyl)acetamide |
| SMILES | CCN(CC)c1ccc(/C=C2/SC(=S)N(c3cccc(SC)c3)C2=O)c(OCC(=O)Nc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C29H28N4O5S3/c1-4-31(5-2)21-13-12-19(14-26-28(35)32(29(39)41-26)22-9-7-11-24(16-22)40-3)25(17-21)38-18-27(34)30-20-8-6-10-23(15-20)33(36)37/h6-17H,4-5,18H2,1-3H3,(H,30,34)/b26-14+ |
| InChIKey | UKAJWHGBWUNCHG-VULFUBBASA-N |
| XLogP | 6.59 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.77 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|