C28H26N4O6S — CID 126280265
2-[5-(diethylamino)-2-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-nitrophenyl)acetamide (PubChem CID 126280265) has the molecular formula C28H26N4O6S and a molecular weight of 546.61 g/mol. Its IUPAC name is 2-[5-(diethylamino)-2-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[5-(diethylamino)-2-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126280265 |
| Molecular Formula | C28H26N4O6S |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | 2-[5-(diethylamino)-2-[(Z)-(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-nitrophenyl)acetamide |
| SMILES | CCN(CC)c1ccc(/C=C2\SC(=O)N(c3ccccc3)C2=O)c(OCC(=O)Nc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C28H26N4O6S/c1-3-30(4-2)22-14-13-19(15-25-27(34)31(28(35)39-25)21-10-6-5-7-11-21)24(17-22)38-18-26(33)29-20-9-8-12-23(16-20)32(36)37/h5-17H,3-4,18H2,1-2H3,(H,29,33)/b25-15- |
| InChIKey | VMDKTXABQZTYJY-MYYYXRDXSA-N |
| XLogP | 5.70 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|