C22H22N4O5S2 — CID 126351833
2-[5-(diethylamino)-2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-nitrophenyl)acetamide (PubChem CID 126351833) has the molecular formula C22H22N4O5S2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 2-[5-(diethylamino)-2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[5-(diethylamino)-2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126351833 |
| Molecular Formula | C22H22N4O5S2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 2-[5-(diethylamino)-2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(3-nitrophenyl)acetamide |
| SMILES | CCN(CC)c1ccc(/C=C2\SC(=S)NC2=O)c(OCC(=O)Nc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C22H22N4O5S2/c1-3-25(4-2)16-9-8-14(10-19-21(28)24-22(32)33-19)18(12-16)31-13-20(27)23-15-6-5-7-17(11-15)26(29)30/h5-12H,3-4,13H2,1-2H3,(H,23,27)(H,24,28,32)/b19-10- |
| InChIKey | MBJBCNOSFADRQV-GRSHGNNSSA-N |
| XLogP | 3.95 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|