C18H13N3O5S2 — CID 18808538
N-(3-nitrophenyl)-2-[2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 18808538) has the molecular formula C18H13N3O5S2 and a molecular weight of 415.45 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2-[2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | N-(3-nitrophenyl)-2-[2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 18808538 |
| Molecular Formula | C18H13N3O5S2 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | N-(3-nitrophenyl)-2-[2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccccc1/C=C1\SC(=S)NC1=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13N3O5S2/c22-16(19-12-5-3-6-13(9-12)21(24)25)10-26-14-7-2-1-4-11(14)8-15-17(23)20-18(27)28-15/h1-9H,10H2,(H,19,22)(H,20,23,27)/b15-8- |
| InChIKey | NSOAIQMMBPTNKS-NVNXTCNLSA-N |
| XLogP | 3.10 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|