C26H26ClN5O5 — CID 126069233
3-chloro-N-[(Z)-[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126069233) has the molecular formula C26H26ClN5O5 and a molecular weight of 523.98 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 3-chloro-N-[(Z)-[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126069233 |
| Molecular Formula | C26H26ClN5O5 |
| Molecular Weight | 523.98 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 3-chloro-N-[(Z)-[4-(diethylamino)-2-[2-(3-nitroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)c2cccc(Cl)c2)c(OCC(=O)Nc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C26H26ClN5O5/c1-3-31(4-2)22-12-11-19(16-28-30-26(34)18-7-5-8-20(27)13-18)24(15-22)37-17-25(33)29-21-9-6-10-23(14-21)32(35)36/h5-16H,3-4,17H2,1-2H3,(H,29,33)(H,30,34)/b28-16- |
| InChIKey | BRZZBQBXUWBZEB-NTFVMDSBSA-N |
| XLogP | 4.88 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.98 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|