C25H24Cl2FN3O2 — CID 83290831
3-chloro-N-[(E)-[2-[(2-chloro-6-fluorophenyl)methoxy]-4-(diethylamino)phenyl]methylideneamino]benzamide (PubChem CID 83290831) has the molecular formula C25H24Cl2FN3O2 and a molecular weight of 488.39 g/mol. Its IUPAC name is 3-chloro-N-[(E)-[2-[(2-chloro-6-fluorophenyl)methoxy]-4-(diethylamino)phenyl]methylideneamino]benzamide.
| Compound Name | 3-chloro-N-[(E)-[2-[(2-chloro-6-fluorophenyl)methoxy]-4-(diethylamino)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 83290831 |
| Molecular Formula | C25H24Cl2FN3O2 |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 3-chloro-N-[(E)-[2-[(2-chloro-6-fluorophenyl)methoxy]-4-(diethylamino)phenyl]methylideneamino]benzamide |
| SMILES | CCN(CC)c1ccc(/C=N/NC(=O)c2cccc(Cl)c2)c(OCc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C25H24Cl2FN3O2/c1-3-31(4-2)20-12-11-18(15-29-30-25(32)17-7-5-8-19(26)13-17)24(14-20)33-16-21-22(27)9-6-10-23(21)28/h5-15H,3-4,16H2,1-2H3,(H,30,32)/b29-15+ |
| InChIKey | JRGUQALODRFQFL-WKULSOCRSA-N |
| XLogP | 6.32 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|