C24H31ClN4O3 — CID 3560997
3-chloro-N-[1-[2-[[4-(diethylamino)-2-methoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 3560997) has the molecular formula C24H31ClN4O3 and a molecular weight of 458.99 g/mol. Its IUPAC name is 3-chloro-N-[1-[2-[[4-(diethylamino)-2-methoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 3-chloro-N-[1-[2-[[4-(diethylamino)-2-methoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 3560997 |
| Molecular Formula | C24H31ClN4O3 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 3-chloro-N-[1-[2-[[4-(diethylamino)-2-methoxyphenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)C(NC(=O)c2cccc(Cl)c2)C(C)C)c(OC)c1 |
| InChI | InChI=1S/C24H31ClN4O3/c1-6-29(7-2)20-12-11-18(21(14-20)32-5)15-26-28-24(31)22(16(3)4)27-23(30)17-9-8-10-19(25)13-17/h8-16,22H,6-7H2,1-5H3,(H,27,30)(H,28,31) |
| InChIKey | SLOJMSHNDSKHBJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|