C26H36N6O4 — CID 21214226
N-[[4-(diethylamino)-2-methoxyphenyl]methylideneamino]-N'-[(E)-[4-(diethylamino)-2-methoxyphenyl]methylideneamino]oxamide (PubChem CID 21214226) has the molecular formula C26H36N6O4 and a molecular weight of 496.61 g/mol. Its IUPAC name is N-[[4-(diethylamino)-2-methoxyphenyl]methylideneamino]-N'-[(E)-[4-(diethylamino)-2-methoxyphenyl]methylideneamino]oxamide.
| Compound Name | N-[[4-(diethylamino)-2-methoxyphenyl]methylideneamino]-N'-[(E)-[4-(diethylamino)-2-methoxyphenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 21214226 |
| Molecular Formula | C26H36N6O4 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | N-[[4-(diethylamino)-2-methoxyphenyl]methylideneamino]-N'-[(E)-[4-(diethylamino)-2-methoxyphenyl]methylideneamino]oxamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)C(=O)N/N=C/c2ccc(N(CC)CC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C26H36N6O4/c1-7-31(8-2)21-13-11-19(23(15-21)35-5)17-27-29-25(33)26(34)30-28-18-20-12-14-22(16-24(20)36-6)32(9-3)10-4/h11-18H,7-10H2,1-6H3,(H,29,33)(H,30,34)/b27-17+,28-18? |
| InChIKey | YKIXTNUWPQLUKK-WCLXIJTESA-N |
| XLogP | 3.00 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|