C21H25FN4O3 — CID 4026615
N'-[[4-(diethylamino)-2-methoxyphenyl]methylideneamino]-N-(2-fluorophenyl)propanediamide (PubChem CID 4026615) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is N'-[[4-(diethylamino)-2-methoxyphenyl]methylideneamino]-N-(2-fluorophenyl)propanediamide.
| Compound Name | N'-[[4-(diethylamino)-2-methoxyphenyl]methylideneamino]-N-(2-fluorophenyl)propanediamide |
|---|---|
| PubChem CID | 4026615 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N'-[[4-(diethylamino)-2-methoxyphenyl]methylideneamino]-N-(2-fluorophenyl)propanediamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)CC(=O)Nc2ccccc2F)c(OC)c1 |
| InChI | InChI=1S/C21H25FN4O3/c1-4-26(5-2)16-11-10-15(19(12-16)29-3)14-23-25-21(28)13-20(27)24-18-9-7-6-8-17(18)22/h6-12,14H,4-5,13H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | KKTAXGATZUJEKQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|