C16H13ClFN3O3 — CID 135716005
N'-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-N-(2-fluorophenyl)propanediamide (PubChem CID 135716005) has the molecular formula C16H13ClFN3O3 and a molecular weight of 349.75 g/mol. Its IUPAC name is N'-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-N-(2-fluorophenyl)propanediamide.
| Compound Name | N'-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-N-(2-fluorophenyl)propanediamide |
|---|---|
| PubChem CID | 135716005 |
| Molecular Formula | C16H13ClFN3O3 |
| Molecular Weight | 349.75 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | N'-[(E)-(5-chloro-2-hydroxyphenyl)methylideneamino]-N-(2-fluorophenyl)propanediamide |
| SMILES | O=C(CC(=O)Nc1ccccc1F)N/N=C/c1cc(Cl)ccc1O |
| InChI | InChI=1S/C16H13ClFN3O3/c17-11-5-6-14(22)10(7-11)9-19-21-16(24)8-15(23)20-13-4-2-1-3-12(13)18/h1-7,9,22H,8H2,(H,20,23)(H,21,24)/b19-9+ |
| InChIKey | NCAYOVGJWJZIRJ-DJKKODMXSA-N |
| XLogP | 2.66 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.75 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|