C20H16FN3O3 — CID 135613934
N-(2-fluorophenyl)-N'-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]propanediamide (PubChem CID 135613934) has the molecular formula C20H16FN3O3 and a molecular weight of 365.36 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N'-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]propanediamide.
| Compound Name | N-(2-fluorophenyl)-N'-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 135613934 |
| Molecular Formula | C20H16FN3O3 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-(2-fluorophenyl)-N'-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]propanediamide |
| SMILES | O=C(CC(=O)Nc1ccccc1F)N/N=C/c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C20H16FN3O3/c21-16-7-3-4-8-17(16)23-19(26)11-20(27)24-22-12-15-14-6-2-1-5-13(14)9-10-18(15)25/h1-10,12,25H,11H2,(H,23,26)(H,24,27)/b22-12+ |
| InChIKey | QTULLMYEQQYOHG-WSDLNYQXSA-N |
| XLogP | 3.16 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|