C29H28N4O4 — CID 3500050
N,N'-bis[(2-hydroxynaphthalen-1-yl)methylideneamino]heptanediamide (PubChem CID 3500050) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is N,N'-bis[(2-hydroxynaphthalen-1-yl)methylideneamino]heptanediamide.
| Compound Name | N,N'-bis[(2-hydroxynaphthalen-1-yl)methylideneamino]heptanediamide |
|---|---|
| PubChem CID | 3500050 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N,N'-bis[(2-hydroxynaphthalen-1-yl)methylideneamino]heptanediamide |
| SMILES | O=C(CCCCCC(=O)NN=Cc1c(O)ccc2ccccc12)NN=Cc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C29H28N4O4/c34-26-16-14-20-8-4-6-10-22(20)24(26)18-30-32-28(36)12-2-1-3-13-29(37)33-31-19-25-23-11-7-5-9-21(23)15-17-27(25)35/h4-11,14-19,34-35H,1-3,12-13H2,(H,32,36)(H,33,37) |
| InChIKey | RIRAZSPOHCHAPW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|