C28H26N4O4 — CID 135616078
N,N'-bis[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]hexanediamide (PubChem CID 135616078) has the molecular formula C28H26N4O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is N,N'-bis[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]hexanediamide.
| Compound Name | N,N'-bis[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]hexanediamide |
|---|---|
| PubChem CID | 135616078 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N,N'-bis[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]hexanediamide |
| SMILES | O=C(CCCCC(=O)N/N=C/c1c(O)ccc2ccccc12)N/N=C/c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C28H26N4O4/c33-25-15-13-19-7-1-3-9-21(19)23(25)17-29-31-27(35)11-5-6-12-28(36)32-30-18-24-22-10-4-2-8-20(22)14-16-26(24)34/h1-4,7-10,13-18,33-34H,5-6,11-12H2,(H,31,35)(H,32,36)/b29-17+,30-18+ |
| InChIKey | NDHPCRVMLBYKSR-YAGSLNJISA-N |
| XLogP | 4.57 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|