C23H18N4O3 — CID 135533440
1,3-bis[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]urea (PubChem CID 135533440) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is 1,3-bis[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]urea.
| Compound Name | 1,3-bis[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 135533440 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1,3-bis[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]urea |
| SMILES | O=C(N/N=C/c1c(O)ccc2ccccc12)N/N=C/c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C23H18N4O3/c28-21-11-9-15-5-1-3-7-17(15)19(21)13-24-26-23(30)27-25-14-20-18-8-4-2-6-16(18)10-12-22(20)29/h1-14,28-29H,(H2,26,27,30)/b24-13+,25-14+ |
| InChIKey | NZONBJBNHBVJMR-GUJRAXHGSA-N |
| XLogP | 4.07 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|