C24H18N2O2 — CID 135472549
N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-4-phenylbenzamide (PubChem CID 135472549) has the molecular formula C24H18N2O2 and a molecular weight of 366.42 g/mol. Its IUPAC name is N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-4-phenylbenzamide.
| Compound Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-4-phenylbenzamide |
|---|---|
| PubChem CID | 135472549 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-4-phenylbenzamide |
| SMILES | O=C(N/N=C/c1c(O)ccc2ccccc12)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H18N2O2/c27-23-15-14-19-8-4-5-9-21(19)22(23)16-25-26-24(28)20-12-10-18(11-13-20)17-6-2-1-3-7-17/h1-16,27H,(H,26,28)/b25-16+ |
| InChIKey | RPMLCOMZPSDSGJ-PCLIKHOPSA-N |
| XLogP | 4.98 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|