C13H11N3O3 — CID 2643236
N'-[(2-hydroxynaphthalen-1-yl)methylideneamino]oxamide (PubChem CID 2643236) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is N'-[(2-hydroxynaphthalen-1-yl)methylideneamino]oxamide.
| Compound Name | N'-[(2-hydroxynaphthalen-1-yl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 2643236 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N'-[(2-hydroxynaphthalen-1-yl)methylideneamino]oxamide |
| SMILES | NC(=O)C(=O)NN=Cc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C13H11N3O3/c14-12(18)13(19)16-15-7-10-9-4-2-1-3-8(9)5-6-11(10)17/h1-7,17H,(H2,14,18)(H,16,19) |
| InChIKey | PMYANXVJTOZPMD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|