C16H15N3O3 — CID 3537553
N-cyclopropyl-N'-[(2-hydroxynaphthalen-1-yl)methylideneamino]oxamide (PubChem CID 3537553) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-cyclopropyl-N'-[(2-hydroxynaphthalen-1-yl)methylideneamino]oxamide.
| Compound Name | N-cyclopropyl-N'-[(2-hydroxynaphthalen-1-yl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 3537553 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-cyclopropyl-N'-[(2-hydroxynaphthalen-1-yl)methylideneamino]oxamide |
| SMILES | O=C(NN=Cc1c(O)ccc2ccccc12)C(=O)NC1CC1 |
| InChI | InChI=1S/C16H15N3O3/c20-14-8-5-10-3-1-2-4-12(10)13(14)9-17-19-16(22)15(21)18-11-6-7-11/h1-5,8-9,11,20H,6-7H2,(H,18,21)(H,19,22) |
| InChIKey | YXQMXNUDUCBZMP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|